C6H8N2O2S — CID 174645355
[1-amino-2-(1,3-thiazol-4-yl)ethyl] formate (PubChem CID 174645355) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is [1-amino-2-(1,3-thiazol-4-yl)ethyl] formate.
| Compound Name | [1-amino-2-(1,3-thiazol-4-yl)ethyl] formate |
|---|---|
| PubChem CID | 174645355 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | [1-amino-2-(1,3-thiazol-4-yl)ethyl] formate |
| SMILES | NC(Cc1cscn1)OC=O |
| InChI | InChI=1S/C6H8N2O2S/c7-6(10-4-9)1-5-2-11-3-8-5/h2-4,6H,1,7H2 |
| InChIKey | NGLOTHILUAVHAQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|