C7H11NO2S — CID 163525054
(2S)-2-methyl-3-(1,3-thiazol-4-yl)propane-1,1-diol (PubChem CID 163525054) has the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. Its IUPAC name is (2S)-2-methyl-3-(1,3-thiazol-4-yl)propane-1,1-diol.
| Compound Name | (2S)-2-methyl-3-(1,3-thiazol-4-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 163525054 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | (2S)-2-methyl-3-(1,3-thiazol-4-yl)propane-1,1-diol |
| SMILES | C[C@@H](Cc1cscn1)C(O)O |
| InChI | InChI=1S/C7H11NO2S/c1-5(7(9)10)2-6-3-11-4-8-6/h3-5,7,9-10H,2H2,1H3/t5-/m0/s1 |
| InChIKey | DOANQGFBVAIXEM-YFKPBYRVSA-N |
| XLogP | 0.63 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|