C11H11N3O2S — CID 174555012
[1-(pyridin-3-ylamino)-2-(1,3-thiazol-4-yl)ethyl] formate (PubChem CID 174555012) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is [1-(pyridin-3-ylamino)-2-(1,3-thiazol-4-yl)ethyl] formate.
| Compound Name | [1-(pyridin-3-ylamino)-2-(1,3-thiazol-4-yl)ethyl] formate |
|---|---|
| PubChem CID | 174555012 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [1-(pyridin-3-ylamino)-2-(1,3-thiazol-4-yl)ethyl] formate |
| SMILES | O=COC(Cc1cscn1)Nc1cccnc1 |
| InChI | InChI=1S/C11H11N3O2S/c15-8-16-11(4-10-6-17-7-13-10)14-9-2-1-3-12-5-9/h1-3,5-8,11,14H,4H2 |
| InChIKey | QTRUGJSMXBRDQK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|