C11H10N2O2S — CID 175251940
[1-pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl] formate (PubChem CID 175251940) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is [1-pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl] formate.
| Compound Name | [1-pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl] formate |
|---|---|
| PubChem CID | 175251940 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | [1-pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl] formate |
| SMILES | O=COC(Cc1cncs1)c1cccnc1 |
| InChI | InChI=1S/C11H10N2O2S/c14-8-15-11(4-10-6-13-7-16-10)9-2-1-3-12-5-9/h1-3,5-8,11H,4H2 |
| InChIKey | MDKFGRLKIKNTCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|