C9H13N3O2 — CID 55269109
(4S)-4-amino-4-(6-amino-3-pyridinyl)butanoic acid (PubChem CID 55269109) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is (4S)-4-amino-4-(6-amino-3-pyridinyl)butanoic acid.
| Compound Name | (4S)-4-amino-4-(6-amino-3-pyridinyl)butanoic acid |
|---|---|
| PubChem CID | 55269109 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (4S)-4-amino-4-(6-amino-3-pyridinyl)butanoic acid |
| SMILES | Nc1ccc([C@@H](N)CCC(=O)O)cn1 |
| InChI | InChI=1S/C9H13N3O2/c10-7(2-4-9(13)14)6-1-3-8(11)12-5-6/h1,3,5,7H,2,4,10H2,(H2,11,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | KZXMFFIUBDMCTC-ZETCQYMHSA-N |
| XLogP | 0.53 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |