C6H6N2OS — CID 91123962
3-amino-3-(1,3-thiazol-4-yl)prop-1-en-1-one (PubChem CID 91123962) has the molecular formula C6H6N2OS and a molecular weight of 154.19 g/mol. Its IUPAC name is 3-amino-3-(1,3-thiazol-4-yl)prop-1-en-1-one.
| Compound Name | 3-amino-3-(1,3-thiazol-4-yl)prop-1-en-1-one |
|---|---|
| PubChem CID | 91123962 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 3-amino-3-(1,3-thiazol-4-yl)prop-1-en-1-one |
| SMILES | NC(C=C=O)c1cscn1 |
| InChI | InChI=1S/C6H6N2OS/c7-5(1-2-9)6-3-10-4-8-6/h1,3-5H,7H2 |
| InChIKey | CVVYINVETQJSIS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|