C6H6BrNO2S — CID 174536644
[2-bromo-2-(1,3-thiazol-4-yl)ethyl] formate (PubChem CID 174536644) has the molecular formula C6H6BrNO2S and a molecular weight of 236.09 g/mol. Its IUPAC name is [2-bromo-2-(1,3-thiazol-4-yl)ethyl] formate.
| Compound Name | [2-bromo-2-(1,3-thiazol-4-yl)ethyl] formate |
|---|---|
| PubChem CID | 174536644 |
| Molecular Formula | C6H6BrNO2S |
| Molecular Weight | 236.09 g/mol |
| Exact Mass | 234.93 |
| IUPAC Name | [2-bromo-2-(1,3-thiazol-4-yl)ethyl] formate |
| SMILES | O=COCC(Br)c1cscn1 |
| InChI | InChI=1S/C6H6BrNO2S/c7-5(1-10-4-9)6-2-11-3-8-6/h2-5H,1H2 |
| InChIKey | VSFNLXSPAORLOY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.09 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|