C8H8N2O2S — CID 174524866
[3-cyano-2-(1,3-thiazol-4-yl)propyl] formate (PubChem CID 174524866) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is [3-cyano-2-(1,3-thiazol-4-yl)propyl] formate.
| Compound Name | [3-cyano-2-(1,3-thiazol-4-yl)propyl] formate |
|---|---|
| PubChem CID | 174524866 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | [3-cyano-2-(1,3-thiazol-4-yl)propyl] formate |
| SMILES | N#CCC(COC=O)c1cscn1 |
| InChI | InChI=1S/C8H8N2O2S/c9-2-1-7(3-12-6-11)8-4-13-5-10-8/h4-7H,1,3H2 |
| InChIKey | XPXUCMCJCJNGQD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|