C10H11Cl2NS — CID 163794224
4-[(2S,3E,5E)-4,5-dichlorohepta-3,5-dien-2-yl]-1,3-thiazole (PubChem CID 163794224) has the molecular formula C10H11Cl2NS and a molecular weight of 248.18 g/mol. Its IUPAC name is 4-[(2S,3E,5E)-4,5-dichlorohepta-3,5-dien-2-yl]-1,3-thiazole.
| Compound Name | 4-[(2S,3E,5E)-4,5-dichlorohepta-3,5-dien-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 163794224 |
| Molecular Formula | C10H11Cl2NS |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 4-[(2S,3E,5E)-4,5-dichlorohepta-3,5-dien-2-yl]-1,3-thiazole |
| SMILES | C/C=C(Cl)\C(Cl)=C/[C@H](C)c1cscn1 |
| InChI | InChI=1S/C10H11Cl2NS/c1-3-8(11)9(12)4-7(2)10-5-14-6-13-10/h3-7H,1-2H3/b8-3+,9-4+/t7-/m0/s1 |
| InChIKey | MZKCOIGUOCFAMJ-LUKBHNTBSA-N |
| XLogP | 4.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|