C11H24N2S2 — CID 143105883
4-(3,3-dimethylbutan-2-yl)-1,3-thiazole;ethane;thiohydroxylamine (PubChem CID 143105883) has the molecular formula C11H24N2S2 and a molecular weight of 248.46 g/mol. Its IUPAC name is 4-(3,3-dimethylbutan-2-yl)-1,3-thiazole;ethane;thiohydroxylamine.
| Compound Name | 4-(3,3-dimethylbutan-2-yl)-1,3-thiazole;ethane;thiohydroxylamine |
|---|---|
| PubChem CID | 143105883 |
| Molecular Formula | C11H24N2S2 |
| Molecular Weight | 248.46 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-(3,3-dimethylbutan-2-yl)-1,3-thiazole;ethane;thiohydroxylamine |
| SMILES | CC.CC(c1cscn1)C(C)(C)C.NS |
| InChI | InChI=1S/C9H15NS.C2H6.H3NS/c1-7(9(2,3)4)8-5-11-6-10-8;2*1-2/h5-7H,1-4H3;1-2H3;2H,1H2 |
| InChIKey | GGNPMQGBTRQWCN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|