C13H10N2OS — CID 81220836
quinolin-7-yl(1,3-thiazol-4-yl)methanol (PubChem CID 81220836) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is quinolin-7-yl(1,3-thiazol-4-yl)methanol.
| Compound Name | quinolin-7-yl(1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 81220836 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | quinolin-7-yl(1,3-thiazol-4-yl)methanol |
| SMILES | OC(c1ccc2cccnc2c1)c1cscn1 |
| InChI | InChI=1S/C13H10N2OS/c16-13(12-7-17-8-15-12)10-4-3-9-2-1-5-14-11(9)6-10/h1-8,13,16H |
| InChIKey | CHKYWZSVWXWYSH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |