C10H11NO2S — CID 131020969
(2-ethylfuran-3-yl)-(1,3-thiazol-4-yl)methanol (PubChem CID 131020969) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is (2-ethylfuran-3-yl)-(1,3-thiazol-4-yl)methanol.
| Compound Name | (2-ethylfuran-3-yl)-(1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 131020969 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (2-ethylfuran-3-yl)-(1,3-thiazol-4-yl)methanol |
| SMILES | CCc1occc1C(O)c1cscn1 |
| InChI | InChI=1S/C10H11NO2S/c1-2-9-7(3-4-13-9)10(12)8-5-14-6-11-8/h3-6,10,12H,2H2,1H3 |
| InChIKey | ZFVFRTGPPOSYOP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |