C9H11N3OS — CID 130508759
(1-ethylimidazol-4-yl)-(1,3-thiazol-4-yl)methanol (PubChem CID 130508759) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is (1-ethylimidazol-4-yl)-(1,3-thiazol-4-yl)methanol.
| Compound Name | (1-ethylimidazol-4-yl)-(1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 130508759 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (1-ethylimidazol-4-yl)-(1,3-thiazol-4-yl)methanol |
| SMILES | CCn1cnc(C(O)c2cscn2)c1 |
| InChI | InChI=1S/C9H11N3OS/c1-2-12-3-7(10-5-12)9(13)8-4-14-6-11-8/h3-6,9,13H,2H2,1H3 |
| InChIKey | RLGFIYFJXLFDQF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |