C9H10ClN3OS — CID 114638381
(4-chloro-1-ethylpyrazol-5-yl)-(1,3-thiazol-4-yl)methanol (PubChem CID 114638381) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-(1,3-thiazol-4-yl)methanol.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-(1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 114638381 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-(1,3-thiazol-4-yl)methanol |
| SMILES | CCn1ncc(Cl)c1C(O)c1cscn1 |
| InChI | InChI=1S/C9H10ClN3OS/c1-2-13-8(6(10)3-12-13)9(14)7-4-15-5-11-7/h3-5,9,14H,2H2,1H3 |
| InChIKey | BDULFDYVNBHRDJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |