C9H7FN2OS — CID 104738089
(3-fluoro-4-pyridinyl)-(1,3-thiazol-4-yl)methanol (PubChem CID 104738089) has the molecular formula C9H7FN2OS and a molecular weight of 210.23 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-(1,3-thiazol-4-yl)methanol.
| Compound Name | (3-fluoro-4-pyridinyl)-(1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 104738089 |
| Molecular Formula | C9H7FN2OS |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-(1,3-thiazol-4-yl)methanol |
| SMILES | OC(c1cscn1)c1ccncc1F |
| InChI | InChI=1S/C9H7FN2OS/c10-7-3-11-2-1-6(7)9(13)8-4-14-5-12-8/h1-5,9,13H |
| InChIKey | MYXXDPVSXSWUQP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |