C15H16FNO4 — CID 104737555
(3-fluoro-4-pyridinyl)-(2,4,5-trimethoxyphenyl)methanol (PubChem CID 104737555) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-(2,4,5-trimethoxyphenyl)methanol.
| Compound Name | (3-fluoro-4-pyridinyl)-(2,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 104737555 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-(2,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)c(C(O)c2ccncc2F)cc1OC |
| InChI | InChI=1S/C15H16FNO4/c1-19-12-7-14(21-3)13(20-2)6-10(12)15(18)9-4-5-17-8-11(9)16/h4-8,15,18H,1-3H3 |
| InChIKey | BSUARLUOUINVGJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |