C12H22N2O2S — CID 113488367
1-(4-methylsulfanylbutyl)-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 113488367) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 1-(4-methylsulfanylbutyl)-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-(4-methylsulfanylbutyl)-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 113488367 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-(4-methylsulfanylbutyl)-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CSCCCCN1C(=O)CNC(=O)C1C(C)C |
| InChI | InChI=1S/C12H22N2O2S/c1-9(2)11-12(16)13-8-10(15)14(11)6-4-5-7-17-3/h9,11H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | JJOAVUDDQFAHPH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|