C17H21N — CID 113488696
1-ethyl-N-(naphthalen-2-ylmethyl)cyclobutan-1-amine (PubChem CID 113488696) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-ethyl-N-(naphthalen-2-ylmethyl)cyclobutan-1-amine.
| Compound Name | 1-ethyl-N-(naphthalen-2-ylmethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 113488696 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-ethyl-N-(naphthalen-2-ylmethyl)cyclobutan-1-amine |
| SMILES | CCC1(NCc2ccc3ccccc3c2)CCC1 |
| InChI | InChI=1S/C17H21N/c1-2-17(10-5-11-17)18-13-14-8-9-15-6-3-4-7-16(15)12-14/h3-4,6-9,12,18H,2,5,10-11,13H2,1H3 |
| InChIKey | ZWNAMVMSGWJZOX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |