C13H22N4 — CID 113491544
N-cyclopropyl-N'-(4-methyl-6-propan-2-ylpyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 113491544) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-cyclopropyl-N'-(4-methyl-6-propan-2-ylpyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(4-methyl-6-propan-2-ylpyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 113491544 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N-cyclopropyl-N'-(4-methyl-6-propan-2-ylpyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | Cc1cc(C(C)C)nc(NCCNC2CC2)n1 |
| InChI | InChI=1S/C13H22N4/c1-9(2)12-8-10(3)16-13(17-12)15-7-6-14-11-4-5-11/h8-9,11,14H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | DFVRLXSYCZJEHY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|