C12H22F3NO — CID 113492081
3-methyl-1-[[3-(trifluoromethyl)cyclohexyl]amino]butan-2-ol (PubChem CID 113492081) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-methyl-1-[[3-(trifluoromethyl)cyclohexyl]amino]butan-2-ol.
| Compound Name | 3-methyl-1-[[3-(trifluoromethyl)cyclohexyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 113492081 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-methyl-1-[[3-(trifluoromethyl)cyclohexyl]amino]butan-2-ol |
| SMILES | CC(C)C(O)CNC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H22F3NO/c1-8(2)11(17)7-16-10-5-3-4-9(6-10)12(13,14)15/h8-11,16-17H,3-7H2,1-2H3 |
| InChIKey | NFXBJUHYWKNCGK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |