C20H25N3O2S — CID 11349252
2-[3-(2-methoxyethoxy)phenyl]-3-methyl-6-(2-methylpropylsulfanyl)imidazo[1,2-b]pyridazine (PubChem CID 11349252) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)phenyl]-3-methyl-6-(2-methylpropylsulfanyl)imidazo[1,2-b]pyridazine.
| Compound Name | 2-[3-(2-methoxyethoxy)phenyl]-3-methyl-6-(2-methylpropylsulfanyl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 11349252 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)phenyl]-3-methyl-6-(2-methylpropylsulfanyl)imidazo[1,2-b]pyridazine |
| SMILES | COCCOc1cccc(-c2nc3ccc(SCC(C)C)nn3c2C)c1 |
| InChI | InChI=1S/C20H25N3O2S/c1-14(2)13-26-19-9-8-18-21-20(15(3)23(18)22-19)16-6-5-7-17(12-16)25-11-10-24-4/h5-9,12,14H,10-11,13H2,1-4H3 |
| InChIKey | BNFCHAOPVLHEQU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|