C20H23N3O3 — CID 11382631
6-(cyclopropylmethoxy)-2-[3-(2-methoxyethoxy)phenyl]-3-methylimidazo[1,2-b]pyridazine (PubChem CID 11382631) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 6-(cyclopropylmethoxy)-2-[3-(2-methoxyethoxy)phenyl]-3-methylimidazo[1,2-b]pyridazine.
| Compound Name | 6-(cyclopropylmethoxy)-2-[3-(2-methoxyethoxy)phenyl]-3-methylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 11382631 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-(cyclopropylmethoxy)-2-[3-(2-methoxyethoxy)phenyl]-3-methylimidazo[1,2-b]pyridazine |
| SMILES | COCCOc1cccc(-c2nc3ccc(OCC4CC4)nn3c2C)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-20(16-4-3-5-17(12-16)25-11-10-24-2)21-18-8-9-19(22-23(14)18)26-13-15-6-7-15/h3-5,8-9,12,15H,6-7,10-11,13H2,1-2H3 |
| InChIKey | PFFCTCOEBODWCX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|