C16H22N4O — CID 170147983
5-[3-[(4-methylcyclohexyl)methoxy]phenyl]-2H-triazol-4-amine (PubChem CID 170147983) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-[3-[(4-methylcyclohexyl)methoxy]phenyl]-2H-triazol-4-amine.
| Compound Name | 5-[3-[(4-methylcyclohexyl)methoxy]phenyl]-2H-triazol-4-amine |
|---|---|
| PubChem CID | 170147983 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-[3-[(4-methylcyclohexyl)methoxy]phenyl]-2H-triazol-4-amine |
| SMILES | CC1CCC(COc2cccc(-c3n[nH]nc3N)c2)CC1 |
| InChI | InChI=1S/C16H22N4O/c1-11-5-7-12(8-6-11)10-21-14-4-2-3-13(9-14)15-16(17)19-20-18-15/h2-4,9,11-12H,5-8,10H2,1H3,(H3,17,18,19,20) |
| InChIKey | ZBNQALONXAKRSN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |