C15H19N3O — CID 68877599
5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl]-1H-pyrazol-3-amine (PubChem CID 68877599) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 68877599 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl]-1H-pyrazol-3-amine |
| SMILES | Nc1cc(CCc2cccc(OCC3CC3)c2)[nH]n1 |
| InChI | InChI=1S/C15H19N3O/c16-15-9-13(17-18-15)7-6-11-2-1-3-14(8-11)19-10-12-4-5-12/h1-3,8-9,12H,4-7,10H2,(H3,16,17,18) |
| InChIKey | LZXNOAFBKPJJGO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |