C10H21N3O3S — CID 113493476
N-(methylcarbamoyl)-2-(4-methylsulfinylbutan-2-ylamino)propanamide (PubChem CID 113493476) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is N-(methylcarbamoyl)-2-(4-methylsulfinylbutan-2-ylamino)propanamide.
| Compound Name | N-(methylcarbamoyl)-2-(4-methylsulfinylbutan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 113493476 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(methylcarbamoyl)-2-(4-methylsulfinylbutan-2-ylamino)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)NC(C)CCS(C)=O |
| InChI | InChI=1S/C10H21N3O3S/c1-7(5-6-17(4)16)12-8(2)9(14)13-10(15)11-3/h7-8,12H,5-6H2,1-4H3,(H2,11,13,14,15) |
| InChIKey | WYNYEPGUXUJFJR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |