C13H21N3O3 — CID 60677139
2-[4-(furan-2-yl)butan-2-ylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 60677139) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)butan-2-ylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[4-(furan-2-yl)butan-2-ylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 60677139 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[4-(furan-2-yl)butan-2-ylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)NC(C)CCc1ccco1 |
| InChI | InChI=1S/C13H21N3O3/c1-9(6-7-11-5-4-8-19-11)15-10(2)12(17)16-13(18)14-3/h4-5,8-10,15H,6-7H2,1-3H3,(H2,14,16,17,18) |
| InChIKey | GMHHLEWTFKQMRA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |