C12H19N3O3 — CID 60638480
N-(ethylcarbamoyl)-2-[2-(furan-2-yl)ethylamino]propanamide (PubChem CID 60638480) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[2-(furan-2-yl)ethylamino]propanamide.
| Compound Name | N-(ethylcarbamoyl)-2-[2-(furan-2-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 60638480 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[2-(furan-2-yl)ethylamino]propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NCCc1ccco1 |
| InChI | InChI=1S/C12H19N3O3/c1-3-13-12(17)15-11(16)9(2)14-7-6-10-5-4-8-18-10/h4-5,8-9,14H,3,6-7H2,1-2H3,(H2,13,15,16,17) |
| InChIKey | CIEVEOKHBMHMTD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |