C18H23N3O3 — CID 31297357
(2S)-2-[[(2S)-4-(furan-2-yl)butan-2-yl]amino]-N-(methylcarbamoyl)-2-phenylacetamide (PubChem CID 31297357) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-(furan-2-yl)butan-2-yl]amino]-N-(methylcarbamoyl)-2-phenylacetamide.
| Compound Name | (2S)-2-[[(2S)-4-(furan-2-yl)butan-2-yl]amino]-N-(methylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 31297357 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2S)-2-[[(2S)-4-(furan-2-yl)butan-2-yl]amino]-N-(methylcarbamoyl)-2-phenylacetamide |
| SMILES | CNC(=O)NC(=O)[C@@H](N[C@@H](C)CCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c1-13(10-11-15-9-6-12-24-15)20-16(14-7-4-3-5-8-14)17(22)21-18(23)19-2/h3-9,12-13,16,20H,10-11H2,1-2H3,(H2,19,21,22,23)/t13-,16-/m0/s1 |
| InChIKey | BCYGCMXVMPWQLN-BBRMVZONSA-N |
| XLogP | 2.39 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |