C15H26N2O2 — CID 43750748
2-[4-(furan-2-yl)butan-2-ylamino]-N,4-dimethylpentanamide (PubChem CID 43750748) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)butan-2-ylamino]-N,4-dimethylpentanamide.
| Compound Name | 2-[4-(furan-2-yl)butan-2-ylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 43750748 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-[4-(furan-2-yl)butan-2-ylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(C)CCc1ccco1 |
| InChI | InChI=1S/C15H26N2O2/c1-11(2)10-14(15(18)16-4)17-12(3)7-8-13-6-5-9-19-13/h5-6,9,11-12,14,17H,7-8,10H2,1-4H3,(H,16,18) |
| InChIKey | ORAMZDRFCBBKJR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |