C11H19N3O2 — CID 77030711
2-[4-(furan-2-yl)butan-2-ylamino]-N'-hydroxypropanimidamide (PubChem CID 77030711) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)butan-2-ylamino]-N'-hydroxypropanimidamide.
| Compound Name | 2-[4-(furan-2-yl)butan-2-ylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77030711 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-[4-(furan-2-yl)butan-2-ylamino]-N'-hydroxypropanimidamide |
| SMILES | CC(CCc1ccco1)NC(C)C(N)=NO |
| InChI | InChI=1S/C11H19N3O2/c1-8(13-9(2)11(12)14-15)5-6-10-4-3-7-16-10/h3-4,7-9,13,15H,5-6H2,1-2H3,(H2,12,14) |
| InChIKey | OLBUAOVMPRRLBB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|