About 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide
3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide (PubChem CID 113497065) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide.
Molecular Properties
| Compound Name | 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide |
| PubChem CID | 113497065 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)CC(N)CC(=O)N(CC1CC1)C1CC1 |
| InChI | InChI=1S/C15H28N2O/c1-15(2,3)9-12(16)8-14(18)17(13-6-7-13)10-11-4-5-11/h11-13H,4-10,16H2,1-3H3 |
| InChIKey | JIBSLTDJUFPIEY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide?
The IUPAC name of 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide (CID 113497065) is 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide.
What is the SMILES notation for 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide?
The canonical SMILES for 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide is CC(C)(C)CC(N)CC(=O)N(CC1CC1)C1CC1.
What is the InChIKey of 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide?
The InChIKey is JIBSLTDJUFPIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-15(2,3)9-12(16)8-14(18)17(13-6-7-13)10-11-4-5-11/h11-13H,4-10,16H2,1-3H3.
What are the key properties of 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide?
3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide has a molecular weight of 252.40 g/mol, XLogP of 2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5,5-dimethylhexanamide is sourced from PubChem (CID 113497065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).