C13H25NO — CID 116614733
5-amino-1-cyclopropyl-7,7-dimethyloctan-3-one (PubChem CID 116614733) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-7,7-dimethyloctan-3-one.
| Compound Name | 5-amino-1-cyclopropyl-7,7-dimethyloctan-3-one |
|---|---|
| PubChem CID | 116614733 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 5-amino-1-cyclopropyl-7,7-dimethyloctan-3-one |
| SMILES | CC(C)(C)CC(N)CC(=O)CCC1CC1 |
| InChI | InChI=1S/C13H25NO/c1-13(2,3)9-11(14)8-12(15)7-6-10-4-5-10/h10-11H,4-9,14H2,1-3H3 |
| InChIKey | AQBHOVWPMMMFCX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |