C16H31NO2 — CID 114341466
(4,4-dimethylcyclohexyl) 3-amino-5,5-dimethylhexanoate (PubChem CID 114341466) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) 3-amino-5,5-dimethylhexanoate.
| Compound Name | (4,4-dimethylcyclohexyl) 3-amino-5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 114341466 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (4,4-dimethylcyclohexyl) 3-amino-5,5-dimethylhexanoate |
| SMILES | CC(C)(C)CC(N)CC(=O)OC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H31NO2/c1-15(2,3)11-12(17)10-14(18)19-13-6-8-16(4,5)9-7-13/h12-13H,6-11,17H2,1-5H3 |
| InChIKey | WJTFFKGAPGZMCR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |