C13H25NO — CID 114478091
7-amino-2,9,9-trimethyldec-1-en-5-one (PubChem CID 114478091) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 7-amino-2,9,9-trimethyldec-1-en-5-one.
| Compound Name | 7-amino-2,9,9-trimethyldec-1-en-5-one |
|---|---|
| PubChem CID | 114478091 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 7-amino-2,9,9-trimethyldec-1-en-5-one |
| SMILES | C=C(C)CCC(=O)CC(N)CC(C)(C)C |
| InChI | InChI=1S/C13H25NO/c1-10(2)6-7-12(15)8-11(14)9-13(3,4)5/h11H,1,6-9,14H2,2-5H3 |
| InChIKey | CBUPAIAHFZQVRR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|