C14H29NO2 — CID 113497546
1-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]pentan-3-ol (PubChem CID 113497546) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]pentan-3-ol.
| Compound Name | 1-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]pentan-3-ol |
|---|---|
| PubChem CID | 113497546 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 1-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]pentan-3-ol |
| SMILES | CCOC1CC(NCCC(O)CC)C1(C)CC |
| InChI | InChI=1S/C14H29NO2/c1-5-11(16)8-9-15-12-10-13(17-7-3)14(12,4)6-2/h11-13,15-16H,5-10H2,1-4H3 |
| InChIKey | GJEZGZHGMLQQLS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |