C12H24N2O3 — CID 83210264
2-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]ethyl carbamate (PubChem CID 83210264) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]ethyl carbamate.
| Compound Name | 2-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83210264 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-[(3-ethoxy-2-ethyl-2-methylcyclobutyl)amino]ethyl carbamate |
| SMILES | CCOC1CC(NCCOC(N)=O)C1(C)CC |
| InChI | InChI=1S/C12H24N2O3/c1-4-12(3)9(8-10(12)16-5-2)14-6-7-17-11(13)15/h9-10,14H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | HCLPBCUQIPNGPC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|