C9H8ClN3O6 — CID 113498327
2-[(2-chloro-5-nitrophenyl)carbamoylamino]oxyacetic acid (PubChem CID 113498327) has the molecular formula C9H8ClN3O6 and a molecular weight of 289.63 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitrophenyl)carbamoylamino]oxyacetic acid.
| Compound Name | 2-[(2-chloro-5-nitrophenyl)carbamoylamino]oxyacetic acid |
|---|---|
| PubChem CID | 113498327 |
| Molecular Formula | C9H8ClN3O6 |
| Molecular Weight | 289.63 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-[(2-chloro-5-nitrophenyl)carbamoylamino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C9H8ClN3O6/c10-6-2-1-5(13(17)18)3-7(6)11-9(16)12-19-4-8(14)15/h1-3H,4H2,(H,14,15)(H2,11,12,16) |
| InChIKey | FNLCKBYTWXDLHH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.63 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|