C14H24N2OS — CID 113498930
3-N-(1-ethylsulfanylpropan-2-yl)-5-propan-2-yloxybenzene-1,3-diamine (PubChem CID 113498930) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 3-N-(1-ethylsulfanylpropan-2-yl)-5-propan-2-yloxybenzene-1,3-diamine.
| Compound Name | 3-N-(1-ethylsulfanylpropan-2-yl)-5-propan-2-yloxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 113498930 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-N-(1-ethylsulfanylpropan-2-yl)-5-propan-2-yloxybenzene-1,3-diamine |
| SMILES | CCSCC(C)Nc1cc(N)cc(OC(C)C)c1 |
| InChI | InChI=1S/C14H24N2OS/c1-5-18-9-11(4)16-13-6-12(15)7-14(8-13)17-10(2)3/h6-8,10-11,16H,5,9,15H2,1-4H3 |
| InChIKey | WLTGDQWPNIUOLP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|