C15H16Cl2N2O — CID 80723309
3-N-(3,5-dichlorophenyl)-5-propan-2-yloxybenzene-1,3-diamine (PubChem CID 80723309) has the molecular formula C15H16Cl2N2O and a molecular weight of 311.21 g/mol. Its IUPAC name is 3-N-(3,5-dichlorophenyl)-5-propan-2-yloxybenzene-1,3-diamine.
| Compound Name | 3-N-(3,5-dichlorophenyl)-5-propan-2-yloxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 80723309 |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-N-(3,5-dichlorophenyl)-5-propan-2-yloxybenzene-1,3-diamine |
| SMILES | CC(C)Oc1cc(N)cc(Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C15H16Cl2N2O/c1-9(2)20-15-7-12(18)6-14(8-15)19-13-4-10(16)3-11(17)5-13/h3-9,19H,18H2,1-2H3 |
| InChIKey | VPLOMTUQGIYSFD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|