C16H19BrN2O — CID 82761389
3-N-(2-bromo-5-methylphenyl)-5-propan-2-yloxybenzene-1,3-diamine (PubChem CID 82761389) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 3-N-(2-bromo-5-methylphenyl)-5-propan-2-yloxybenzene-1,3-diamine.
| Compound Name | 3-N-(2-bromo-5-methylphenyl)-5-propan-2-yloxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 82761389 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-N-(2-bromo-5-methylphenyl)-5-propan-2-yloxybenzene-1,3-diamine |
| SMILES | Cc1ccc(Br)c(Nc2cc(N)cc(OC(C)C)c2)c1 |
| InChI | InChI=1S/C16H19BrN2O/c1-10(2)20-14-8-12(18)7-13(9-14)19-16-6-11(3)4-5-15(16)17/h4-10,19H,18H2,1-3H3 |
| InChIKey | CMTSTPNSRDGLRW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|