C17H18N2OS — CID 80740277
3-N-(1-benzothiophen-5-yl)-5-propan-2-yloxybenzene-1,3-diamine (PubChem CID 80740277) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-N-(1-benzothiophen-5-yl)-5-propan-2-yloxybenzene-1,3-diamine.
| Compound Name | 3-N-(1-benzothiophen-5-yl)-5-propan-2-yloxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 80740277 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-N-(1-benzothiophen-5-yl)-5-propan-2-yloxybenzene-1,3-diamine |
| SMILES | CC(C)Oc1cc(N)cc(Nc2ccc3sccc3c2)c1 |
| InChI | InChI=1S/C17H18N2OS/c1-11(2)20-16-9-13(18)8-15(10-16)19-14-3-4-17-12(7-14)5-6-21-17/h3-11,19H,18H2,1-2H3 |
| InChIKey | JTACOFVTMUUXFD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|