C14H12N2S — CID 65475625
2-N-(1-benzothiophen-5-yl)benzene-1,2-diamine (PubChem CID 65475625) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-N-(1-benzothiophen-5-yl)benzene-1,2-diamine.
| Compound Name | 2-N-(1-benzothiophen-5-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65475625 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-N-(1-benzothiophen-5-yl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1Nc1ccc2sccc2c1 |
| InChI | InChI=1S/C14H12N2S/c15-12-3-1-2-4-13(12)16-11-5-6-14-10(9-11)7-8-17-14/h1-9,16H,15H2 |
| InChIKey | SXGQCQVDORVFSN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|