C26H17N5 — CID 11350077
2-[4-[2-methyl-8-(2-pyridin-3-ylethynyl)imidazo[4,5-c]quinolin-1-yl]phenyl]acetonitrile (PubChem CID 11350077) has the molecular formula C26H17N5 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[4-[2-methyl-8-(2-pyridin-3-ylethynyl)imidazo[4,5-c]quinolin-1-yl]phenyl]acetonitrile.
| Compound Name | 2-[4-[2-methyl-8-(2-pyridin-3-ylethynyl)imidazo[4,5-c]quinolin-1-yl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 11350077 |
| Molecular Formula | C26H17N5 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[4-[2-methyl-8-(2-pyridin-3-ylethynyl)imidazo[4,5-c]quinolin-1-yl]phenyl]acetonitrile |
| SMILES | Cc1nc2cnc3ccc(C#Cc4cccnc4)cc3c2n1-c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C26H17N5/c1-18-30-25-17-29-24-11-8-20(4-5-21-3-2-14-28-16-21)15-23(24)26(25)31(18)22-9-6-19(7-10-22)12-13-27/h2-3,6-11,14-17H,12H2,1H3 |
| InChIKey | SUCAWRZDHHYRQV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|