C25H24O5 — CID 11350227
dimethyl (3R,3aS,4R)-6-methyl-5-oxo-3,4-diphenyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 11350227) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is dimethyl (3R,3aS,4R)-6-methyl-5-oxo-3,4-diphenyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl (3R,3aS,4R)-6-methyl-5-oxo-3,4-diphenyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11350227 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | dimethyl (3R,3aS,4R)-6-methyl-5-oxo-3,4-diphenyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(C)C(=O)[C@@H](c3ccccc3)[C@@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H24O5/c1-15-18-14-25(23(27)29-2,24(28)30-3)21(17-12-8-5-9-13-17)20(18)19(22(15)26)16-10-6-4-7-11-16/h4-13,19-21H,14H2,1-3H3/t19-,20+,21-/m0/s1 |
| InChIKey | PVDLAPGLUJTDHG-HBMCJLEFSA-N |
| XLogP | 3.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|