C21H24ClNO5S — CID 11351105
ethyl 4-(4-chlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 11351105) has the molecular formula C21H24ClNO5S and a molecular weight of 437.95 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11351105 |
| Molecular Formula | C21H24ClNO5S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2ccccc2OC)(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H24ClNO5S/c1-3-28-20(24)23-14-12-21(13-15-23,18-6-4-5-7-19(18)27-2)29(25,26)17-10-8-16(22)9-11-17/h4-11H,3,12-15H2,1-2H3 |
| InChIKey | PGWYCWWVRQAMRF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |