C18H17IN2O6 — CID 11352126
(2S,3S)-2-amino-3-[[3-[(4-(125I)iodobenzoyl)amino]phenyl]methoxy]butanedioic acid (PubChem CID 11352126) has the molecular formula C18H17IN2O6 and a molecular weight of 482.25 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-[[3-[(4-(125I)iodobenzoyl)amino]phenyl]methoxy]butanedioic acid.
| Compound Name | (2S,3S)-2-amino-3-[[3-[(4-(125I)iodobenzoyl)amino]phenyl]methoxy]butanedioic acid |
|---|---|
| PubChem CID | 11352126 |
| Molecular Formula | C18H17IN2O6 |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | (2S,3S)-2-amino-3-[[3-[(4-(125I)iodobenzoyl)amino]phenyl]methoxy]butanedioic acid |
| SMILES | N[C@H](C(=O)O)[C@H](OCc1cccc(NC(=O)c2ccc([125I])cc2)c1)C(=O)O |
| InChI | InChI=1S/C18H17IN2O6/c19-12-6-4-11(5-7-12)16(22)21-13-3-1-2-10(8-13)9-27-15(18(25)26)14(20)17(23)24/h1-8,14-15H,9,20H2,(H,21,22)(H,23,24)(H,25,26)/t14-,15-/m0/s1/i19-2 |
| InChIKey | NRFSLZOAIQNIKO-HJRIMICESA-N |
| XLogP | 1.93 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|