C24H32N4O6S — CID 11352632
tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-[4-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamate (PubChem CID 11352632) has the molecular formula C24H32N4O6S and a molecular weight of 504.61 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-[4-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-[4-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11352632 |
| Molecular Formula | C24H32N4O6S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-[4-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CON(C)C(=O)[C@H](Cc1ccc(/C(N)=N/S(=O)(=O)c2ccc(C)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32N4O6S/c1-16-7-13-19(14-8-16)35(31,32)27-21(25)18-11-9-17(10-12-18)15-20(22(29)28(5)33-6)26-23(30)34-24(2,3)4/h7-14,20H,15H2,1-6H3,(H2,25,27)(H,26,30)/t20-/m0/s1 |
| InChIKey | WDVBNRLFOJTGQE-FQEVSTJZSA-N |
| XLogP | 2.54 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|