C27H19Cl2N7O2 — CID 11353280
7,8-bis(4-chlorophenyl)-5-methyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazine-3,6-dione (PubChem CID 11353280) has the molecular formula C27H19Cl2N7O2 and a molecular weight of 544.40 g/mol. Its IUPAC name is 7,8-bis(4-chlorophenyl)-5-methyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazine-3,6-dione.
| Compound Name | 7,8-bis(4-chlorophenyl)-5-methyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazine-3,6-dione |
|---|---|
| PubChem CID | 11353280 |
| Molecular Formula | C27H19Cl2N7O2 |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 7,8-bis(4-chlorophenyl)-5-methyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazine-3,6-dione |
| SMILES | Cn1c(=O)c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c2nn(Cc3ccc(-n4cncn4)cc3)c(=O)n21 |
| InChI | InChI=1S/C27H19Cl2N7O2/c1-33-26(37)24(19-6-10-21(29)11-7-19)23(18-4-8-20(28)9-5-18)25-32-34(27(38)36(25)33)14-17-2-12-22(13-3-17)35-16-30-15-31-35/h2-13,15-16H,14H2,1H3 |
| InChIKey | VLCOMKJSGFOUFN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |