C27H17Cl2F3N6O — CID 11410513
7,8-bis(4-chlorophenyl)-12-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9,11-tetraen-3-one (PubChem CID 11410513) has the molecular formula C27H17Cl2F3N6O and a molecular weight of 569.37 g/mol. Its IUPAC name is 7,8-bis(4-chlorophenyl)-12-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9,11-tetraen-3-one.
| Compound Name | 7,8-bis(4-chlorophenyl)-12-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 11410513 |
| Molecular Formula | C27H17Cl2F3N6O |
| Molecular Weight | 569.37 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 7,8-bis(4-chlorophenyl)-12-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9,11-tetraen-3-one |
| SMILES | Cc1nnc2c(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c3nn(Cc4ccc(C(F)(F)F)cc4)c(=O)n3n12 |
| InChI | InChI=1S/C27H17Cl2F3N6O/c1-15-33-34-24-22(17-4-10-20(28)11-5-17)23(18-6-12-21(29)13-7-18)25-35-36(26(39)38(25)37(15)24)14-16-2-8-19(9-3-16)27(30,31)32/h2-13H,14H2,1H3 |
| InChIKey | CPZCAOKTQCZJGA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 69.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.37 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |