C25H17Cl2F3N6O — CID 59515515
7,8-bis(4-chlorophenyl)-6-hydrazinyl-2-[[4-(trifluoromethyl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 59515515) has the molecular formula C25H17Cl2F3N6O and a molecular weight of 545.35 g/mol. Its IUPAC name is 7,8-bis(4-chlorophenyl)-6-hydrazinyl-2-[[4-(trifluoromethyl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 7,8-bis(4-chlorophenyl)-6-hydrazinyl-2-[[4-(trifluoromethyl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 59515515 |
| Molecular Formula | C25H17Cl2F3N6O |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | 7,8-bis(4-chlorophenyl)-6-hydrazinyl-2-[[4-(trifluoromethyl)phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | NNc1nn2c(=O)n(Cc3ccc(C(F)(F)F)cc3)nc2c(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17Cl2F3N6O/c26-18-9-3-15(4-10-18)20-21(16-5-11-19(27)12-6-16)23-34-35(24(37)36(23)33-22(20)32-31)13-14-1-7-17(8-2-14)25(28,29)30/h1-12H,13,31H2,(H,32,33) |
| InChIKey | UAMOFUCNYRJOSM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|